CAS No: 6208-60-2, Chemical Name: 2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole
the physical and chemical property of 6208-60-2, 2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole is provided by ChemNet.com
ChemNet > CAS > 6208-60-2 2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole
6208-60-2 2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole
Naam product |
2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole |
Synoniemen |
1H-Pyrido[4,3-b]indole, 2,3,4,5-tetrahydro-; 2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole; 2,3,4,5-Tetrahydrl-1H-pyrido[4,3-b]indole |
MF |
C11H12N2 |
Molecuulgewicht |
172.2264 |
InChI |
InChI=1/C11H12N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-4,12-13H,5-7H2 |
CAS-nummer |
6208-60-2 |
Moleculaire Structuur |
|
Dichtheid |
1.189g/cm3 |
Kookpunt |
351.6°C at 760 mmHg |
Brekingsindex |
1.669 |
Vlampunt |
166.5°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|